C11H13NO2 — CID 174811970
3,4-dihydro-2H-quinolin-1-ylmethyl formate (PubChem CID 174811970) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-ylmethyl formate.
| Compound Name | 3,4-dihydro-2H-quinolin-1-ylmethyl formate |
|---|---|
| PubChem CID | 174811970 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-ylmethyl formate |
| SMILES | O=COCN1CCCc2ccccc21 |
| InChI | InChI=1S/C11H13NO2/c13-9-14-8-12-7-3-5-10-4-1-2-6-11(10)12/h1-2,4,6,9H,3,5,7-8H2 |
| InChIKey | MHXSRUSCRCLJBZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|