C15H24NO3P — CID 167883099
1-(2-diethoxyphosphorylethyl)-3,4-dihydro-2H-quinoline (PubChem CID 167883099) has the molecular formula C15H24NO3P and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-(2-diethoxyphosphorylethyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(2-diethoxyphosphorylethyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 167883099 |
| Molecular Formula | C15H24NO3P |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(2-diethoxyphosphorylethyl)-3,4-dihydro-2H-quinoline |
| SMILES | CCOP(=O)(CCN1CCCc2ccccc21)OCC |
| InChI | InChI=1S/C15H24NO3P/c1-3-18-20(17,19-4-2)13-12-16-11-7-9-14-8-5-6-10-15(14)16/h5-6,8,10H,3-4,7,9,11-13H2,1-2H3 |
| InChIKey | GIAUPKXZVQJKAV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|