C13H16ClN — CID 77051840
1-(4-chlorobut-2-enyl)-3,4-dihydro-2H-quinoline (PubChem CID 77051840) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 1-(4-chlorobut-2-enyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(4-chlorobut-2-enyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 77051840 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-(4-chlorobut-2-enyl)-3,4-dihydro-2H-quinoline |
| SMILES | ClCC=CCN1CCCc2ccccc21 |
| InChI | InChI=1S/C13H16ClN/c14-9-3-4-10-15-11-5-7-12-6-1-2-8-13(12)15/h1-4,6,8H,5,7,9-11H2 |
| InChIKey | AWXRWTOCOIBEEQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|