C11H12FN — CID 175249463
1-(3-fluoroprop-2-enyl)-2,3-dihydroindole (PubChem CID 175249463) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 1-(3-fluoroprop-2-enyl)-2,3-dihydroindole.
| Compound Name | 1-(3-fluoroprop-2-enyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 175249463 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-(3-fluoroprop-2-enyl)-2,3-dihydroindole |
| SMILES | FC=CCN1CCc2ccccc21 |
| InChI | InChI=1S/C11H12FN/c12-7-3-8-13-9-6-10-4-1-2-5-11(10)13/h1-5,7H,6,8-9H2 |
| InChIKey | WZEQYDFUVUZOBQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |