C19H27N — CID 145126037
ethane;1-phenyl-3,4-dihydro-2H-quinoline (PubChem CID 145126037) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is ethane;1-phenyl-3,4-dihydro-2H-quinoline.
| Compound Name | ethane;1-phenyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 145126037 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | ethane;1-phenyl-3,4-dihydro-2H-quinoline |
| SMILES | CC.CC.c1ccc(N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C15H15N.2C2H6/c1-2-9-14(10-3-1)16-12-6-8-13-7-4-5-11-15(13)16;2*1-2/h1-5,7,9-11H,6,8,12H2;2*1-2H3 |
| InChIKey | QMHPLXQQCKMFBD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |