C16H16ClN — CID 28946417
1-[4-(chloromethyl)phenyl]-3,4-dihydro-2H-quinoline (PubChem CID 28946417) has the molecular formula C16H16ClN and a molecular weight of 257.76 g/mol. Its IUPAC name is 1-[4-(chloromethyl)phenyl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[4-(chloromethyl)phenyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 28946417 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-[4-(chloromethyl)phenyl]-3,4-dihydro-2H-quinoline |
| SMILES | ClCc1ccc(N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H16ClN/c17-12-13-7-9-15(10-8-13)18-11-3-5-14-4-1-2-6-16(14)18/h1-2,4,6-10H,3,5,11-12H2 |
| InChIKey | LMGOZADOEDLNHT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|