C15H16ClN3 — CID 107373522
1-[5-(chloromethyl)pyrazin-2-yl]-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 107373522) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is 1-[5-(chloromethyl)pyrazin-2-yl]-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 1-[5-(chloromethyl)pyrazin-2-yl]-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 107373522 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-[5-(chloromethyl)pyrazin-2-yl]-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | ClCc1cnc(N2CCCCc3ccccc32)cn1 |
| InChI | InChI=1S/C15H16ClN3/c16-9-13-10-18-15(11-17-13)19-8-4-3-6-12-5-1-2-7-14(12)19/h1-2,5,7,10-11H,3-4,6,8-9H2 |
| InChIKey | PKYFFIAVLARKCW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|