C14H14ClN3 — CID 107373295
2-[5-(chloromethyl)pyrazin-2-yl]-3,4-dihydro-1H-isoquinoline (PubChem CID 107373295) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-[5-(chloromethyl)pyrazin-2-yl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[5-(chloromethyl)pyrazin-2-yl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 107373295 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-[5-(chloromethyl)pyrazin-2-yl]-3,4-dihydro-1H-isoquinoline |
| SMILES | ClCc1cnc(N2CCc3ccccc3C2)cn1 |
| InChI | InChI=1S/C14H14ClN3/c15-7-13-8-17-14(9-16-13)18-6-5-11-3-1-2-4-12(11)10-18/h1-4,8-9H,5-7,10H2 |
| InChIKey | OERRKJIBLLWKNW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|