C13H12IN3 — CID 115620482
2-(5-iodopyrimidin-2-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 115620482) has the molecular formula C13H12IN3 and a molecular weight of 337.16 g/mol. Its IUPAC name is 2-(5-iodopyrimidin-2-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(5-iodopyrimidin-2-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 115620482 |
| Molecular Formula | C13H12IN3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-(5-iodopyrimidin-2-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | Ic1cnc(N2CCc3ccccc3C2)nc1 |
| InChI | InChI=1S/C13H12IN3/c14-12-7-15-13(16-8-12)17-6-5-10-3-1-2-4-11(10)9-17/h1-4,7-8H,5-6,9H2 |
| InChIKey | HJHIPCRUEFNVCH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|