C14H16N4 — CID 80652652
5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrazin-2-amine (PubChem CID 80652652) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrazin-2-amine.
| Compound Name | 5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 80652652 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)pyrazin-2-amine |
| SMILES | Nc1cnc(N2CCCc3ccccc3C2)cn1 |
| InChI | InChI=1S/C14H16N4/c15-13-8-17-14(9-16-13)18-7-3-6-11-4-1-2-5-12(11)10-18/h1-2,4-5,8-9H,3,6-7,10H2,(H2,15,16) |
| InChIKey | ZKILBFMTDJLGDL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |