C15H18N4O2 — CID 80651956
5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrazin-2-amine (PubChem CID 80651956) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrazin-2-amine.
| Compound Name | 5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 80651956 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pyrazin-2-amine |
| SMILES | COc1cc2c(cc1OC)CN(c1cnc(N)cn1)CC2 |
| InChI | InChI=1S/C15H18N4O2/c1-20-12-5-10-3-4-19(9-11(10)6-13(12)21-2)15-8-17-14(16)7-18-15/h5-8H,3-4,9H2,1-2H3,(H2,16,17) |
| InChIKey | KWHSZHAGHNUTJD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |