C22H24IN3O4 — CID 18765188
2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-5-iodo-6,7-dimethoxyquinolin-4-amine (PubChem CID 18765188) has the molecular formula C22H24IN3O4 and a molecular weight of 521.36 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-5-iodo-6,7-dimethoxyquinolin-4-amine.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-5-iodo-6,7-dimethoxyquinolin-4-amine |
|---|---|
| PubChem CID | 18765188 |
| Molecular Formula | C22H24IN3O4 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-5-iodo-6,7-dimethoxyquinolin-4-amine |
| SMILES | COc1cc2c(cc1OC)CN(c1cc(N)c3c(I)c(OC)c(OC)cc3n1)CC2 |
| InChI | InChI=1S/C22H24IN3O4/c1-27-16-7-12-5-6-26(11-13(12)8-17(16)28-2)19-9-14(24)20-15(25-19)10-18(29-3)22(30-4)21(20)23/h7-10H,5-6,11H2,1-4H3,(H2,24,25) |
| InChIKey | UAISNJSAZMHJSZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|