About 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride
6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride (PubChem CID 90673657) has the molecular formula C15H21ClN4O2
and a molecular weight of 324.81 g/mol. Its IUPAC name is 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride |
| PubChem CID | 90673657 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride |
| SMILES | COc1cc2nc(N3CCNCC3)cc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C15H20N4O2.ClH/c1-20-13-7-10-11(16)8-15(19-5-3-17-4-6-19)18-12(10)9-14(13)21-2;/h7-9,17H,3-6H2,1-2H3,(H2,16,18);1H |
| InChIKey | MNMUQTBAXDZEAG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride?
The IUPAC name of 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride (CID 90673657) is 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride.
What is the SMILES notation for 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride?
The canonical SMILES for 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride is COc1cc2nc(N3CCNCC3)cc(N)c2cc1OC.Cl.
What is the InChIKey of 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride?
The InChIKey is MNMUQTBAXDZEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2.ClH/c1-20-13-7-10-11(16)8-15(19-5-3-17-4-6-19)18-12(10)9-14(13)21-2;/h7-9,17H,3-6H2,1-2H3,(H2,16,18);1H.
What are the key properties of 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride?
6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride has a molecular weight of 324.81 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2-piperazin-1-ylquinolin-4-amine;hydrochloride is sourced from PubChem (CID 90673657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).