C12H15ClN2O2 — CID 91665053
6,7-dimethoxy-2-methylquinolin-4-amine;hydrochloride (PubChem CID 91665053) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methylquinolin-4-amine;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-methylquinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 91665053 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 6,7-dimethoxy-2-methylquinolin-4-amine;hydrochloride |
| SMILES | COc1cc2nc(C)cc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C12H14N2O2.ClH/c1-7-4-9(13)8-5-11(15-2)12(16-3)6-10(8)14-7;/h4-6H,1-3H3,(H2,13,14);1H |
| InChIKey | FVODNCIJXORXAN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |