C24H28Cl2N4O2 — CID 163277411
6-[4-(4-amino-2-methylquinolin-6-yl)oxybutoxy]-2-methylquinolin-4-amine;dihydrochloride (PubChem CID 163277411) has the molecular formula C24H28Cl2N4O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 6-[4-(4-amino-2-methylquinolin-6-yl)oxybutoxy]-2-methylquinolin-4-amine;dihydrochloride.
| Compound Name | 6-[4-(4-amino-2-methylquinolin-6-yl)oxybutoxy]-2-methylquinolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 163277411 |
| Molecular Formula | C24H28Cl2N4O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 6-[4-(4-amino-2-methylquinolin-6-yl)oxybutoxy]-2-methylquinolin-4-amine;dihydrochloride |
| SMILES | Cc1cc(N)c2cc(OCCCCOc3ccc4nc(C)cc(N)c4c3)ccc2n1.Cl.Cl |
| InChI | InChI=1S/C24H26N4O2.2ClH/c1-15-11-21(25)19-13-17(5-7-23(19)27-15)29-9-3-4-10-30-18-6-8-24-20(14-18)22(26)12-16(2)28-24;;/h5-8,11-14H,3-4,9-10H2,1-2H3,(H2,25,27)(H2,26,28);2*1H |
| InChIKey | FNXKRXFXANZKMD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|