C21H22Cl2N6O — CID 21115634
1,1-bis(4-amino-2-methylquinolin-6-yl)urea;dihydrochloride (PubChem CID 21115634) has the molecular formula C21H22Cl2N6O and a molecular weight of 445.35 g/mol. Its IUPAC name is 1,1-bis(4-amino-2-methylquinolin-6-yl)urea;dihydrochloride.
| Compound Name | 1,1-bis(4-amino-2-methylquinolin-6-yl)urea;dihydrochloride |
|---|---|
| PubChem CID | 21115634 |
| Molecular Formula | C21H22Cl2N6O |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 1,1-bis(4-amino-2-methylquinolin-6-yl)urea;dihydrochloride |
| SMILES | Cc1cc(N)c2cc(N(C(N)=O)c3ccc4nc(C)cc(N)c4c3)ccc2n1.Cl.Cl |
| InChI | InChI=1S/C21H20N6O.2ClH/c1-11-7-17(22)15-9-13(3-5-19(15)25-11)27(21(24)28)14-4-6-20-16(10-14)18(23)8-12(2)26-20;;/h3-10H,1-2H3,(H2,22,25)(H2,23,26)(H2,24,28);2*1H |
| InChIKey | KHPJXQZWCBRIQT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |