About 2-methylquinolin-4-amine
2-methylquinolin-4-amine (PubChem CID 162035180) has the molecular formula C20H20N4
and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-methylquinolin-4-amine.
Molecular Properties
| Compound Name | 2-methylquinolin-4-amine |
| PubChem CID | 162035180 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-methylquinolin-4-amine |
| SMILES | Cc1cc(N)c2ccccc2n1.Cc1cc(N)c2ccccc2n1 |
| InChI | InChI=1S/2C10H10N2/c2*1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2*2-6H,1H3,(H2,11,12) |
| InChIKey | YWNZRGJXZAZFCA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinolin-4-amine?
The IUPAC name of 2-methylquinolin-4-amine (CID 162035180) is 2-methylquinolin-4-amine.
What is the SMILES notation for 2-methylquinolin-4-amine?
The canonical SMILES for 2-methylquinolin-4-amine is Cc1cc(N)c2ccccc2n1.Cc1cc(N)c2ccccc2n1.
What is the InChIKey of 2-methylquinolin-4-amine?
The InChIKey is YWNZRGJXZAZFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H10N2/c2*1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2*2-6H,1H3,(H2,11,12).
What are the key properties of 2-methylquinolin-4-amine?
2-methylquinolin-4-amine has a molecular weight of 316.41 g/mol, XLogP of 4.25, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinolin-4-amine is sourced from PubChem (CID 162035180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).