About 2-phenylquinolin-4-amine;hydrochloride
2-phenylquinolin-4-amine;hydrochloride (PubChem CID 134690731) has the molecular formula C15H13ClN2
and a molecular weight of 256.74 g/mol. Its IUPAC name is 2-phenylquinolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-phenylquinolin-4-amine;hydrochloride |
| PubChem CID | 134690731 |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-phenylquinolin-4-amine;hydrochloride |
| SMILES | Cl.Nc1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C15H12N2.ClH/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H2,16,17);1H |
| InChIKey | WKNBMKQOTRRCLC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylquinolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylquinolin-4-amine;hydrochloride?
The IUPAC name of 2-phenylquinolin-4-amine;hydrochloride (CID 134690731) is 2-phenylquinolin-4-amine;hydrochloride.
What is the SMILES notation for 2-phenylquinolin-4-amine;hydrochloride?
The canonical SMILES for 2-phenylquinolin-4-amine;hydrochloride is Cl.Nc1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of 2-phenylquinolin-4-amine;hydrochloride?
The InChIKey is WKNBMKQOTRRCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2.ClH/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H2,16,17);1H.
What are the key properties of 2-phenylquinolin-4-amine;hydrochloride?
2-phenylquinolin-4-amine;hydrochloride has a molecular weight of 256.74 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylquinolin-4-amine;hydrochloride is sourced from PubChem (CID 134690731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).