About 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride
1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride (PubChem CID 89405609) has the molecular formula C22H25ClN8O2
and a molecular weight of 468.95 g/mol. Its IUPAC name is 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride.
Molecular Properties
| Compound Name | 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride |
| PubChem CID | 89405609 |
| Molecular Formula | C22H25ClN8O2 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride |
| SMILES | Cc1cc(N)c2cc(NC(=O)Nc3ccc4nc(C)cc(N)c4c3)ccc2n1.Cl.NC(N)=O |
| InChI | InChI=1S/C21H20N6O.CH4N2O.ClH/c1-11-7-17(22)15-9-13(3-5-19(15)24-11)26-21(28)27-14-4-6-20-16(10-14)18(23)8-12(2)25-20;2-1(3)4;/h3-10H,1-2H3,(H2,22,24)(H2,23,25)(H2,26,27,28);(H4,2,3,4);1H |
| InChIKey | PBNZAZPPLDMALY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 188.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride?
The IUPAC name of 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride (CID 89405609) is 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride.
What is the SMILES notation for 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride?
The canonical SMILES for 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride is Cc1cc(N)c2cc(NC(=O)Nc3ccc4nc(C)cc(N)c4c3)ccc2n1.Cl.NC(N)=O.
What is the InChIKey of 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride?
The InChIKey is PBNZAZPPLDMALY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6O.CH4N2O.ClH/c1-11-7-17(22)15-9-13(3-5-19(15)24-11)26-21(28)27-14-4-6-20-16(10-14)18(23)8-12(2)25-20;2-1(3)4;/h3-10H,1-2H3,(H2,22,24)(H2,23,25)(H2,26,27,28);(H4,2,3,4);1H.
What are the key properties of 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride?
1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride has a molecular weight of 468.95 g/mol, XLogP of 3.65, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-amino-2-methylquinolin-6-yl)urea;urea;hydrochloride is sourced from PubChem (CID 89405609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).