C24H21N3O — CID 10546941
N-(4-amino-2-methylquinolin-6-yl)-2-benzylbenzamide (PubChem CID 10546941) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(4-amino-2-methylquinolin-6-yl)-2-benzylbenzamide.
| Compound Name | N-(4-amino-2-methylquinolin-6-yl)-2-benzylbenzamide |
|---|---|
| PubChem CID | 10546941 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(4-amino-2-methylquinolin-6-yl)-2-benzylbenzamide |
| SMILES | Cc1cc(N)c2cc(NC(=O)c3ccccc3Cc3ccccc3)ccc2n1 |
| InChI | InChI=1S/C24H21N3O/c1-16-13-22(25)21-15-19(11-12-23(21)26-16)27-24(28)20-10-6-5-9-18(20)14-17-7-3-2-4-8-17/h2-13,15H,14H2,1H3,(H2,25,26)(H,27,28) |
| InChIKey | OARLHLABDSCPNB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |