C24H21ClFN3O2 — CID 22397066
N-(4-amino-2-methylquinolin-6-yl)-2-[(3-fluorophenoxy)methyl]benzamide;hydrochloride (PubChem CID 22397066) has the molecular formula C24H21ClFN3O2 and a molecular weight of 437.90 g/mol. Its IUPAC name is N-(4-amino-2-methylquinolin-6-yl)-2-[(3-fluorophenoxy)methyl]benzamide;hydrochloride.
| Compound Name | N-(4-amino-2-methylquinolin-6-yl)-2-[(3-fluorophenoxy)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 22397066 |
| Molecular Formula | C24H21ClFN3O2 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-(4-amino-2-methylquinolin-6-yl)-2-[(3-fluorophenoxy)methyl]benzamide;hydrochloride |
| SMILES | Cc1cc(N)c2cc(NC(=O)c3ccccc3COc3cccc(F)c3)ccc2n1.Cl |
| InChI | InChI=1S/C24H20FN3O2.ClH/c1-15-11-22(26)21-13-18(9-10-23(21)27-15)28-24(29)20-8-3-2-5-16(20)14-30-19-7-4-6-17(25)12-19;/h2-13H,14H2,1H3,(H2,26,27)(H,28,29);1H |
| InChIKey | JYMAFMLKUWAQFH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |