C24H23Cl3N4O — CID 160523492
N-(4-amino-2-methylquinolin-6-yl)-2-[(4-chloroanilino)methyl]benzamide;dihydrochloride (PubChem CID 160523492) has the molecular formula C24H23Cl3N4O and a molecular weight of 489.83 g/mol. Its IUPAC name is N-(4-amino-2-methylquinolin-6-yl)-2-[(4-chloroanilino)methyl]benzamide;dihydrochloride.
| Compound Name | N-(4-amino-2-methylquinolin-6-yl)-2-[(4-chloroanilino)methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 160523492 |
| Molecular Formula | C24H23Cl3N4O |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | N-(4-amino-2-methylquinolin-6-yl)-2-[(4-chloroanilino)methyl]benzamide;dihydrochloride |
| SMILES | Cc1cc(N)c2cc(NC(=O)c3ccccc3CNc3ccc(Cl)cc3)ccc2n1.Cl.Cl |
| InChI | InChI=1S/C24H21ClN4O.2ClH/c1-15-12-22(26)21-13-19(10-11-23(21)28-15)29-24(30)20-5-3-2-4-16(20)14-27-18-8-6-17(25)7-9-18;;/h2-13,27H,14H2,1H3,(H2,26,28)(H,29,30);2*1H |
| InChIKey | MLZDDPVQCCFENM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |