C16H26N2O2 — CID 163274874
6,7-dimethoxy-2,4-dimethylquinazoline;ethane (PubChem CID 163274874) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 6,7-dimethoxy-2,4-dimethylquinazoline;ethane.
| Compound Name | 6,7-dimethoxy-2,4-dimethylquinazoline;ethane |
|---|---|
| PubChem CID | 163274874 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 6,7-dimethoxy-2,4-dimethylquinazoline;ethane |
| SMILES | CC.CC.COc1cc2nc(C)nc(C)c2cc1OC |
| InChI | InChI=1S/C12H14N2O2.2C2H6/c1-7-9-5-11(15-3)12(16-4)6-10(9)14-8(2)13-7;2*1-2/h5-6H,1-4H3;2*1-2H3 |
| InChIKey | WJDDFSZJEWLHAD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |