C14H17NO3 — CID 82576000
1-(6,7-dimethoxy-4-methylquinolin-2-yl)ethanol (PubChem CID 82576000) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-(6,7-dimethoxy-4-methylquinolin-2-yl)ethanol.
| Compound Name | 1-(6,7-dimethoxy-4-methylquinolin-2-yl)ethanol |
|---|---|
| PubChem CID | 82576000 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-(6,7-dimethoxy-4-methylquinolin-2-yl)ethanol |
| SMILES | COc1cc2nc(C(C)O)cc(C)c2cc1OC |
| InChI | InChI=1S/C14H17NO3/c1-8-5-11(9(2)16)15-12-7-14(18-4)13(17-3)6-10(8)12/h5-7,9,16H,1-4H3 |
| InChIKey | RIVSNTBQUVCFHY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |