C19H19NO4 — CID 169417890
2-(6,7-dimethoxy-4-methylquinolin-2-yl)-6-methoxyphenol (PubChem CID 169417890) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-4-methylquinolin-2-yl)-6-methoxyphenol.
| Compound Name | 2-(6,7-dimethoxy-4-methylquinolin-2-yl)-6-methoxyphenol |
|---|---|
| PubChem CID | 169417890 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(6,7-dimethoxy-4-methylquinolin-2-yl)-6-methoxyphenol |
| SMILES | COc1cc2nc(-c3cccc(OC)c3O)cc(C)c2cc1OC |
| InChI | InChI=1S/C19H19NO4/c1-11-8-14(12-6-5-7-16(22-2)19(12)21)20-15-10-18(24-4)17(23-3)9-13(11)15/h5-10,21H,1-4H3 |
| InChIKey | HQVQACXYTQYQGP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |