C16H19NO4 — CID 82578176
methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate (PubChem CID 82578176) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate.
| Compound Name | methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate |
|---|---|
| PubChem CID | 82578176 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate |
| SMILES | COC(=O)CCc1cc(C)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C16H19NO4/c1-10-7-11(5-6-16(18)21-4)17-13-9-15(20-3)14(19-2)8-12(10)13/h7-9H,5-6H2,1-4H3 |
| InChIKey | ZAGIZHQFTHARJN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |