methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate

C16H19NO4 — CID 82578176

IUPACmethyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate
SMILESCOC(=O)CCc1cc(C)c2cc(OC)c(OC)cc2n1
InChIInChI=1S/C16H19NO4/c1-10-7-11(5-6-16(18)21-4)17-13-9-15(20-3)14(19-2)8-12(10)13/h7-9H,5-6H2,1-4H3
InChIKeyZAGIZHQFTHARJN-UHFFFAOYSA-N
MW289.33 g/mol
LogP2.67
Rot. Bonds5

About methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate

methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate (PubChem CID 82578176) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate
PubChem CID82578176
Molecular FormulaC16H19NO4
Molecular Weight289.33 g/mol
Exact Mass289.13
IUPAC Namemethyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate
SMILESCOC(=O)CCc1cc(C)c2cc(OC)c(OC)cc2n1
InChIInChI=1S/C16H19NO4/c1-10-7-11(5-6-16(18)21-4)17-13-9-15(20-3)14(19-2)8-12(10)13/h7-9H,5-6H2,1-4H3
InChIKeyZAGIZHQFTHARJN-UHFFFAOYSA-N
XLogP2.67
TPSA57.65 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.33
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate?
The IUPAC name of methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate (CID 82578176) is methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate.
What is the SMILES notation for methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate?
The canonical SMILES for methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate is COC(=O)CCc1cc(C)c2cc(OC)c(OC)cc2n1.
What is the InChIKey of methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate?
The InChIKey is ZAGIZHQFTHARJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c1-10-7-11(5-6-16(18)21-4)17-13-9-15(20-3)14(19-2)8-12(10)13/h7-9H,5-6H2,1-4H3.
What are the key properties of methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate?
methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate has a molecular weight of 289.33 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(6,7-dimethoxy-4-methylquinolin-2-yl)propanoate is sourced from PubChem (CID 82578176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).