C19H18FNO3 — CID 169418540
2-(2-fluoro-6-methoxyphenyl)-6,7-dimethoxy-4-methylquinoline (PubChem CID 169418540) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(2-fluoro-6-methoxyphenyl)-6,7-dimethoxy-4-methylquinoline.
| Compound Name | 2-(2-fluoro-6-methoxyphenyl)-6,7-dimethoxy-4-methylquinoline |
|---|---|
| PubChem CID | 169418540 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-(2-fluoro-6-methoxyphenyl)-6,7-dimethoxy-4-methylquinoline |
| SMILES | COc1cc2nc(-c3c(F)cccc3OC)cc(C)c2cc1OC |
| InChI | InChI=1S/C19H18FNO3/c1-11-8-15(19-13(20)6-5-7-16(19)22-2)21-14-10-18(24-4)17(23-3)9-12(11)14/h5-10H,1-4H3 |
| InChIKey | ZSJPCIOQQWNFPF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |