C19H20N2O4S — CID 169411496
N-[2-(2,6-dimethoxyphenyl)-4-methylquinolin-6-yl]methanesulfonamide (PubChem CID 169411496) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[2-(2,6-dimethoxyphenyl)-4-methylquinolin-6-yl]methanesulfonamide.
| Compound Name | N-[2-(2,6-dimethoxyphenyl)-4-methylquinolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 169411496 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[2-(2,6-dimethoxyphenyl)-4-methylquinolin-6-yl]methanesulfonamide |
| SMILES | COc1cccc(OC)c1-c1cc(C)c2cc(NS(C)(=O)=O)ccc2n1 |
| InChI | InChI=1S/C19H20N2O4S/c1-12-10-16(19-17(24-2)6-5-7-18(19)25-3)20-15-9-8-13(11-14(12)15)21-26(4,22)23/h5-11,21H,1-4H3 |
| InChIKey | LFRDMKFEKLUAJK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |