C21H21NO2 — CID 122206647
6-(2,6-dimethoxyphenyl)-2,4-dimethyl-3-phenylpyridine (PubChem CID 122206647) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)-2,4-dimethyl-3-phenylpyridine.
| Compound Name | 6-(2,6-dimethoxyphenyl)-2,4-dimethyl-3-phenylpyridine |
|---|---|
| PubChem CID | 122206647 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)-2,4-dimethyl-3-phenylpyridine |
| SMILES | COc1cccc(OC)c1-c1cc(C)c(-c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C21H21NO2/c1-14-13-17(21-18(23-3)11-8-12-19(21)24-4)22-15(2)20(14)16-9-6-5-7-10-16/h5-13H,1-4H3 |
| InChIKey | FGTRURQLBFWHKZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |