C19H23N — CID 122206650
6-cyclohexyl-2,4-dimethyl-3-phenylpyridine (PubChem CID 122206650) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 6-cyclohexyl-2,4-dimethyl-3-phenylpyridine.
| Compound Name | 6-cyclohexyl-2,4-dimethyl-3-phenylpyridine |
|---|---|
| PubChem CID | 122206650 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 6-cyclohexyl-2,4-dimethyl-3-phenylpyridine |
| SMILES | Cc1cc(C2CCCCC2)nc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C19H23N/c1-14-13-18(16-9-5-3-6-10-16)20-15(2)19(14)17-11-7-4-8-12-17/h4,7-8,11-13,16H,3,5-6,9-10H2,1-2H3 |
| InChIKey | UYRFFSYJUYINAT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |