C33H48 — CID 175032315
1,3-dicyclohexyl-5-phenyl-2,4,6-tri(propan-2-yl)benzene (PubChem CID 175032315) has the molecular formula C33H48 and a molecular weight of 444.75 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-phenyl-2,4,6-tri(propan-2-yl)benzene.
| Compound Name | 1,3-dicyclohexyl-5-phenyl-2,4,6-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 175032315 |
| Molecular Formula | C33H48 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | 1,3-dicyclohexyl-5-phenyl-2,4,6-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1c(-c2ccccc2)c(C(C)C)c(C2CCCCC2)c(C(C)C)c1C1CCCCC1 |
| InChI | InChI=1S/C33H48/c1-22(2)28-31(25-16-10-7-11-17-25)29(23(3)4)33(27-20-14-9-15-21-27)30(24(5)6)32(28)26-18-12-8-13-19-26/h7,10-11,16-17,22-24,26-27H,8-9,12-15,18-21H2,1-6H3 |
| InChIKey | MKEWRXVMFUDHRN-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |