C16H16Cl2N2 — CID 65429518
4,6-dichloro-2-cyclohexyl-5-phenylpyrimidine (PubChem CID 65429518) has the molecular formula C16H16Cl2N2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 4,6-dichloro-2-cyclohexyl-5-phenylpyrimidine.
| Compound Name | 4,6-dichloro-2-cyclohexyl-5-phenylpyrimidine |
|---|---|
| PubChem CID | 65429518 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4,6-dichloro-2-cyclohexyl-5-phenylpyrimidine |
| SMILES | Clc1nc(C2CCCCC2)nc(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N2/c17-14-13(11-7-3-1-4-8-11)15(18)20-16(19-14)12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | QHDOUROPUFABAR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |