About N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide
N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide (PubChem CID 58960364) has the molecular formula C13H15NO2S
and a molecular weight of 249.34 g/mol. Its IUPAC name is N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide |
| PubChem CID | 58960364 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide |
| SMILES | Cc1cc(NS(C)(=O)=O)cc2c(C)cccc12 |
| InChI | InChI=1S/C13H15NO2S/c1-9-5-4-6-12-10(2)7-11(8-13(9)12)14-17(3,15)16/h4-8,14H,1-3H3 |
| InChIKey | QSIAAKDLNLMABL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide?
The IUPAC name of N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide (CID 58960364) is N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide.
What is the SMILES notation for N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide?
The canonical SMILES for N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide is Cc1cc(NS(C)(=O)=O)cc2c(C)cccc12.
What is the InChIKey of N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide?
The InChIKey is QSIAAKDLNLMABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2S/c1-9-5-4-6-12-10(2)7-11(8-13(9)12)14-17(3,15)16/h4-8,14H,1-3H3.
What are the key properties of N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide?
N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide has a molecular weight of 249.34 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,8-dimethylnaphthalen-2-yl)methanesulfonamide is sourced from PubChem (CID 58960364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).