C13H15N3O3 — CID 144858973
N-(6,7-dimethoxy-2-methylquinazolin-4-yl)acetamide (PubChem CID 144858973) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(6,7-dimethoxy-2-methylquinazolin-4-yl)acetamide.
| Compound Name | N-(6,7-dimethoxy-2-methylquinazolin-4-yl)acetamide |
|---|---|
| PubChem CID | 144858973 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(6,7-dimethoxy-2-methylquinazolin-4-yl)acetamide |
| SMILES | COc1cc2nc(C)nc(NC(C)=O)c2cc1OC |
| InChI | InChI=1S/C13H15N3O3/c1-7-14-10-6-12(19-4)11(18-3)5-9(10)13(15-7)16-8(2)17/h5-6H,1-4H3,(H,14,15,16,17) |
| InChIKey | MLGNKZSCNJSOTE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |