C12H15N5O3 — CID 157480962
[(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]urea (PubChem CID 157480962) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is [(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]urea.
| Compound Name | [(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]urea |
|---|---|
| PubChem CID | 157480962 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | [(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]urea |
| SMILES | COc1cc2nc(C)nc(NNC(N)=O)c2cc1OC |
| InChI | InChI=1S/C12H15N5O3/c1-6-14-8-5-10(20-3)9(19-2)4-7(8)11(15-6)16-17-12(13)18/h4-5H,1-3H3,(H3,13,17,18)(H,14,15,16) |
| InChIKey | ULIMRGKUBPMENH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|