C15H24N6O4 — CID 21155177
[[2-(diethylamino)-6,7-dimethoxyquinazolin-4-yl]amino]urea;hydrate (PubChem CID 21155177) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is [[2-(diethylamino)-6,7-dimethoxyquinazolin-4-yl]amino]urea;hydrate.
| Compound Name | [[2-(diethylamino)-6,7-dimethoxyquinazolin-4-yl]amino]urea;hydrate |
|---|---|
| PubChem CID | 21155177 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [[2-(diethylamino)-6,7-dimethoxyquinazolin-4-yl]amino]urea;hydrate |
| SMILES | CCN(CC)c1nc(NNC(N)=O)c2cc(OC)c(OC)cc2n1.O |
| InChI | InChI=1S/C15H22N6O3.H2O/c1-5-21(6-2)15-17-10-8-12(24-4)11(23-3)7-9(10)13(18-15)19-20-14(16)22;/h7-8H,5-6H2,1-4H3,(H3,16,20,22)(H,17,18,19);1H2 |
| InChIKey | OJOZRHGAUGUEMW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|