C14H20N4O3 — CID 134103872
2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-ethylamino]ethanol (PubChem CID 134103872) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-ethylamino]ethanol.
| Compound Name | 2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-ethylamino]ethanol |
|---|---|
| PubChem CID | 134103872 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)-ethylamino]ethanol |
| SMILES | CCN(CCO)c1nc(N)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C14H20N4O3/c1-4-18(5-6-19)14-16-10-8-12(21-3)11(20-2)7-9(10)13(15)17-14/h7-8,19H,4-6H2,1-3H3,(H2,15,16,17) |
| InChIKey | DYJMNMGCBHOQHO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |