C17H26N4O3 — CID 157201647
6,7,8-trimethoxy-2-N,2-N-dipropylquinazoline-2,4-diamine (PubChem CID 157201647) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 6,7,8-trimethoxy-2-N,2-N-dipropylquinazoline-2,4-diamine.
| Compound Name | 6,7,8-trimethoxy-2-N,2-N-dipropylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 157201647 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 6,7,8-trimethoxy-2-N,2-N-dipropylquinazoline-2,4-diamine |
| SMILES | CCCN(CCC)c1nc(N)c2cc(OC)c(OC)c(OC)c2n1 |
| InChI | InChI=1S/C17H26N4O3/c1-6-8-21(9-7-2)17-19-13-11(16(18)20-17)10-12(22-3)14(23-4)15(13)24-5/h10H,6-9H2,1-5H3,(H2,18,19,20) |
| InChIKey | XWNXWXRUIZIHHW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |