C19H21N3O5 — CID 150058857
4-[(2-amino-6,7,8-trimethoxyquinazolin-4-yl)methyl]-2-methoxyphenol (PubChem CID 150058857) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[(2-amino-6,7,8-trimethoxyquinazolin-4-yl)methyl]-2-methoxyphenol.
| Compound Name | 4-[(2-amino-6,7,8-trimethoxyquinazolin-4-yl)methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 150058857 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[(2-amino-6,7,8-trimethoxyquinazolin-4-yl)methyl]-2-methoxyphenol |
| SMILES | COc1cc(Cc2nc(N)nc3c(OC)c(OC)c(OC)cc23)ccc1O |
| InChI | InChI=1S/C19H21N3O5/c1-24-14-8-10(5-6-13(14)23)7-12-11-9-15(25-2)17(26-3)18(27-4)16(11)22-19(20)21-12/h5-6,8-9,23H,7H2,1-4H3,(H2,20,21,22) |
| InChIKey | DMWLUCPQBUJAPZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |