C22H30N2O3 — CID 144620268
2-amino-4-[(6,7-dimethoxyisoquinolin-4-yl)methyl]phenol;ethane (PubChem CID 144620268) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-amino-4-[(6,7-dimethoxyisoquinolin-4-yl)methyl]phenol;ethane.
| Compound Name | 2-amino-4-[(6,7-dimethoxyisoquinolin-4-yl)methyl]phenol;ethane |
|---|---|
| PubChem CID | 144620268 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-amino-4-[(6,7-dimethoxyisoquinolin-4-yl)methyl]phenol;ethane |
| SMILES | CC.CC.COc1cc2cncc(Cc3ccc(O)c(N)c3)c2cc1OC |
| InChI | InChI=1S/C18H18N2O3.2C2H6/c1-22-17-7-13-10-20-9-12(14(13)8-18(17)23-2)5-11-3-4-16(21)15(19)6-11;2*1-2/h3-4,6-10,21H,5,19H2,1-2H3;2*1-2H3 |
| InChIKey | DAUFGPJDIIMGQE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|