C22H28N2O4 — CID 161062966
4-[(3-amino-4-ethoxy-5-methoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;methane (PubChem CID 161062966) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[(3-amino-4-ethoxy-5-methoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;methane.
| Compound Name | 4-[(3-amino-4-ethoxy-5-methoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;methane |
|---|---|
| PubChem CID | 161062966 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[(3-amino-4-ethoxy-5-methoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;methane |
| SMILES | C.CCOc1ccc2c(Cc3cc(N)c(OCC)c(OC)c3)cncc2c1O |
| InChI | InChI=1S/C21H24N2O4.CH4/c1-4-26-18-7-6-15-14(11-23-12-16(15)20(18)24)8-13-9-17(22)21(27-5-2)19(10-13)25-3;/h6-7,9-12,24H,4-5,8,22H2,1-3H3;1H4 |
| InChIKey | UDQFEOJJEHXDPB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 86.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|