About 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol
4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol (PubChem CID 135993788) has the molecular formula C24H29NO5
and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol.
Molecular Properties
| Compound Name | 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol |
| PubChem CID | 135993788 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol |
| SMILES | CCOc1ccc2c(Cc3cc(OC)c(OC)c(OCC(C)C)c3)cncc2c1O |
| InChI | InChI=1S/C24H29NO5/c1-6-29-20-8-7-18-17(12-25-13-19(18)23(20)26)9-16-10-21(27-4)24(28-5)22(11-16)30-14-15(2)3/h7-8,10-13,15,26H,6,9,14H2,1-5H3 |
| InChIKey | YEOJTSCTBBOUBC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol?
The IUPAC name of 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol (CID 135993788) is 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol.
What is the SMILES notation for 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol?
The canonical SMILES for 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol is CCOc1ccc2c(Cc3cc(OC)c(OC)c(OCC(C)C)c3)cncc2c1O.
What is the InChIKey of 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol?
The InChIKey is YEOJTSCTBBOUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO5/c1-6-29-20-8-7-18-17(12-25-13-19(18)23(20)26)9-16-10-21(27-4)24(28-5)22(11-16)30-14-15(2)3/h7-8,10-13,15,26H,6,9,14H2,1-5H3.
What are the key properties of 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol?
4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol has a molecular weight of 411.50 g/mol, XLogP of 4.98, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,4-dimethoxy-5-(2-methylpropoxy)phenyl]methyl]-7-ethoxyisoquinolin-8-ol is sourced from PubChem (CID 135993788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).