C23H26ClNO5 — CID 135993762
4-[(3,5-dimethoxy-4-prop-2-enoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride (PubChem CID 135993762) has the molecular formula C23H26ClNO5 and a molecular weight of 431.92 g/mol. Its IUPAC name is 4-[(3,5-dimethoxy-4-prop-2-enoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride.
| Compound Name | 4-[(3,5-dimethoxy-4-prop-2-enoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride |
|---|---|
| PubChem CID | 135993762 |
| Molecular Formula | C23H26ClNO5 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[(3,5-dimethoxy-4-prop-2-enoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride |
| SMILES | C=CCOc1c(OC)cc(Cc2cncc3c(O)c(OCC)ccc23)cc1OC.Cl |
| InChI | InChI=1S/C23H25NO5.ClH/c1-5-9-29-23-20(26-3)11-15(12-21(23)27-4)10-16-13-24-14-18-17(16)7-8-19(22(18)25)28-6-2;/h5,7-8,11-14,25H,1,6,9-10H2,2-4H3;1H |
| InChIKey | NYCWZOBFRABBIV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|