C26H26N2O4 — CID 135993739
4-[(4-anilino-3,5-dimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol (PubChem CID 135993739) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 4-[(4-anilino-3,5-dimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol.
| Compound Name | 4-[(4-anilino-3,5-dimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol |
|---|---|
| PubChem CID | 135993739 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[(4-anilino-3,5-dimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol |
| SMILES | CCOc1ccc2c(Cc3cc(OC)c(Nc4ccccc4)c(OC)c3)cncc2c1O |
| InChI | InChI=1S/C26H26N2O4/c1-4-32-22-11-10-20-18(15-27-16-21(20)26(22)29)12-17-13-23(30-2)25(24(14-17)31-3)28-19-8-6-5-7-9-19/h5-11,13-16,28-29H,4,12H2,1-3H3 |
| InChIKey | KVODFSYRASAUOZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |