C23H27NO4S — CID 137161499
4-[(3,5-dimethoxy-4-propoxyphenyl)methyl]-7-ethoxyisoquinoline-8-thiol (PubChem CID 137161499) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is 4-[(3,5-dimethoxy-4-propoxyphenyl)methyl]-7-ethoxyisoquinoline-8-thiol.
| Compound Name | 4-[(3,5-dimethoxy-4-propoxyphenyl)methyl]-7-ethoxyisoquinoline-8-thiol |
|---|---|
| PubChem CID | 137161499 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 4-[(3,5-dimethoxy-4-propoxyphenyl)methyl]-7-ethoxyisoquinoline-8-thiol |
| SMILES | CCCOc1c(OC)cc(Cc2cncc3c(S)c(OCC)ccc23)cc1OC |
| InChI | InChI=1S/C23H27NO4S/c1-5-9-28-22-20(25-3)11-15(12-21(22)26-4)10-16-13-24-14-18-17(16)7-8-19(23(18)29)27-6-2/h7-8,11-14,29H,5-6,9-10H2,1-4H3 |
| InChIKey | OALUGTSBZCKNGW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|