About 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride
4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride (PubChem CID 135993811) has the molecular formula C21H23Cl2NO5
and a molecular weight of 440.32 g/mol. Its IUPAC name is 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride |
| PubChem CID | 135993811 |
| Molecular Formula | C21H23Cl2NO5 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride |
| SMILES | CCOc1ccc2c(Cc3cc(OC)c(OC)c(OC)c3Cl)cncc2c1O.Cl |
| InChI | InChI=1S/C21H22ClNO5.ClH/c1-5-28-16-7-6-14-13(10-23-11-15(14)19(16)24)8-12-9-17(25-2)20(26-3)21(27-4)18(12)22;/h6-7,9-11,24H,5,8H2,1-4H3;1H |
| InChIKey | FEHGXWJJYAKZLZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride?
The IUPAC name of 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride (CID 135993811) is 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride.
What is the SMILES notation for 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride?
The canonical SMILES for 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride is CCOc1ccc2c(Cc3cc(OC)c(OC)c(OC)c3Cl)cncc2c1O.Cl.
What is the InChIKey of 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride?
The InChIKey is FEHGXWJJYAKZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO5.ClH/c1-5-28-16-7-6-14-13(10-23-11-15(14)19(16)24)8-12-9-17(25-2)20(26-3)21(27-4)18(12)22;/h6-7,9-11,24H,5,8H2,1-4H3;1H.
What are the key properties of 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride?
4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride has a molecular weight of 440.32 g/mol, XLogP of 5.03, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-3,4,5-trimethoxyphenyl)methyl]-7-ethoxyisoquinolin-8-ol;hydrochloride is sourced from PubChem (CID 135993811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).