C22H24N2O5 — CID 54760524
(8-amino-7-ethoxyisoquinolin-4-yl)-(4-ethoxy-3,5-dimethoxyphenyl)methanone (PubChem CID 54760524) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is (8-amino-7-ethoxyisoquinolin-4-yl)-(4-ethoxy-3,5-dimethoxyphenyl)methanone.
| Compound Name | (8-amino-7-ethoxyisoquinolin-4-yl)-(4-ethoxy-3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 54760524 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (8-amino-7-ethoxyisoquinolin-4-yl)-(4-ethoxy-3,5-dimethoxyphenyl)methanone |
| SMILES | CCOc1ccc2c(C(=O)c3cc(OC)c(OCC)c(OC)c3)cncc2c1N |
| InChI | InChI=1S/C22H24N2O5/c1-5-28-17-8-7-14-15(20(17)23)11-24-12-16(14)21(25)13-9-18(26-3)22(29-6-2)19(10-13)27-4/h7-12H,5-6,23H2,1-4H3 |
| InChIKey | VURNWSCMLQVQMA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|