About 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine
7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine (PubChem CID 71533224) has the molecular formula C21H24N2O4
and a molecular weight of 368.43 g/mol. Its IUPAC name is 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine.
Molecular Properties
| Compound Name | 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine |
| PubChem CID | 71533224 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine |
| SMILES | CCOc1ccc2cc(Cc3cc(OC)c(OC)c(OC)c3)cnc2c1N |
| InChI | InChI=1S/C21H24N2O4/c1-5-27-16-7-6-15-9-14(12-23-20(15)19(16)22)8-13-10-17(24-2)21(26-4)18(11-13)25-3/h6-7,9-12H,5,8,22H2,1-4H3 |
| InChIKey | USRZUIJSSKCLKD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine?
The IUPAC name of 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine (CID 71533224) is 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine.
What is the SMILES notation for 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine?
The canonical SMILES for 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine is CCOc1ccc2cc(Cc3cc(OC)c(OC)c(OC)c3)cnc2c1N.
What is the InChIKey of 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine?
The InChIKey is USRZUIJSSKCLKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O4/c1-5-27-16-7-6-15-9-14(12-23-20(15)19(16)22)8-13-10-17(24-2)21(26-4)18(11-13)25-3/h6-7,9-12H,5,8,22H2,1-4H3.
What are the key properties of 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine?
7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine has a molecular weight of 368.43 g/mol, XLogP of 3.83, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinolin-8-amine is sourced from PubChem (CID 71533224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).