C16H22N4O4 — CID 101196638
5-[[3-(ethoxymethoxy)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 101196638) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-[[3-(ethoxymethoxy)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[3-(ethoxymethoxy)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 101196638 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 5-[[3-(ethoxymethoxy)-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CCOCOc1cc(Cc2cnc(N)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C16H22N4O4/c1-4-23-9-24-13-7-10(6-12(21-2)14(13)22-3)5-11-8-19-16(18)20-15(11)17/h6-8H,4-5,9H2,1-3H3,(H4,17,18,19,20) |
| InChIKey | UXZGVJMSENDJKQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|