C21H32N4O3 — CID 5279633
5-[(3,5-dimethoxy-4-octoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 5279633) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 5-[(3,5-dimethoxy-4-octoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(3,5-dimethoxy-4-octoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 5279633 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 5-[(3,5-dimethoxy-4-octoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCCCCCCCOc1c(OC)cc(Cc2cnc(N)nc2N)cc1OC |
| InChI | InChI=1S/C21H32N4O3/c1-4-5-6-7-8-9-10-28-19-17(26-2)12-15(13-18(19)27-3)11-16-14-24-21(23)25-20(16)22/h12-14H,4-11H2,1-3H3,(H4,22,23,24,25) |
| InChIKey | KORHZHYZBJNYPV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|